To provide a coloring composition ensuring excellent dispersibility, fluidity and preserving stability while showing high solid content and high pigment concentration by using zinc phthalocyanine pigment with excellent coloring property and further to provide inkjet ink which uses the coloring composition and can be stably ejected and a color filter substrate which is formed by using the inkjet ink.
The coloring composition comprises a solvent(A), pigment(B) and a basic dispersing agent(C). The solvent(A) comprises at least one kind of solvent selected from a group consisting of a solvent (A-1) represented by chemical formula 1: CH3-C(=O)-O-(CnH2nO)m-C(=O)-CH3 and a solvent (A-2) represented by chemical formula 2: R-(O-C3H6)p-O-C(=O)-CH3. The pigment(B) is specific phthalocyanine pigment.
IKEGAMI TOMONORI
NOGAMI TAKAYUKI
TANAKA YOSHIKAZU
JP2006284691A | 2006-10-19 | |||
JP2006299090A | 2006-11-02 | |||
JP2007231248A | 2007-09-13 | |||
JP2007231122A | 2007-09-13 | |||
JP2004339332A | 2004-12-02 | |||
JPH09169821A | 1997-06-30 | |||
JP2007204658A | 2007-08-16 | |||
JP2007226161A | 2007-09-06 | |||
JPS5437082A | 1979-03-19 | |||
JP2009228006A | 2009-10-08 |